About dipyridin-2-ylmethanone;4-phenylbenzaldehyde
dipyridin-2-ylmethanone;4-phenylbenzaldehyde (PubChem CID 87196974) has the molecular formula C24H18N2O2
and a molecular weight of 366.42 g/mol. Its IUPAC name is dipyridin-2-ylmethanone;4-phenylbenzaldehyde.
Molecular Properties
| Compound Name | dipyridin-2-ylmethanone;4-phenylbenzaldehyde |
| PubChem CID | 87196974 |
| Molecular Formula | C24H18N2O2 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | dipyridin-2-ylmethanone;4-phenylbenzaldehyde |
| SMILES | O=C(c1ccccn1)c1ccccn1.O=Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H10O.C11H8N2O/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;14-11(9-5-1-3-7-12-9)10-6-2-4-8-13-10/h1-10H;1-8H |
| InChIKey | BAPAKBOPNAGKHP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze dipyridin-2-ylmethanone;4-phenylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipyridin-2-ylmethanone;4-phenylbenzaldehyde?
The IUPAC name of dipyridin-2-ylmethanone;4-phenylbenzaldehyde (CID 87196974) is dipyridin-2-ylmethanone;4-phenylbenzaldehyde.
What is the SMILES notation for dipyridin-2-ylmethanone;4-phenylbenzaldehyde?
The canonical SMILES for dipyridin-2-ylmethanone;4-phenylbenzaldehyde is O=C(c1ccccn1)c1ccccn1.O=Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of dipyridin-2-ylmethanone;4-phenylbenzaldehyde?
The InChIKey is BAPAKBOPNAGKHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C11H8N2O/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;14-11(9-5-1-3-7-12-9)10-6-2-4-8-13-10/h1-10H;1-8H.
What are the key properties of dipyridin-2-ylmethanone;4-phenylbenzaldehyde?
dipyridin-2-ylmethanone;4-phenylbenzaldehyde has a molecular weight of 366.42 g/mol, XLogP of 4.87, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipyridin-2-ylmethanone;4-phenylbenzaldehyde is sourced from PubChem (CID 87196974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).