C21H15N3O3 — CID 86703062
methyl 7-(4-formylphenyl)-6-phenylimidazo[1,2-a]pyrimidine-2-carboxylate (PubChem CID 86703062) has the molecular formula C21H15N3O3 and a molecular weight of 357.37 g/mol. Its IUPAC name is methyl 7-(4-formylphenyl)-6-phenylimidazo[1,2-a]pyrimidine-2-carboxylate.
| Compound Name | methyl 7-(4-formylphenyl)-6-phenylimidazo[1,2-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 86703062 |
| Molecular Formula | C21H15N3O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | methyl 7-(4-formylphenyl)-6-phenylimidazo[1,2-a]pyrimidine-2-carboxylate |
| SMILES | COC(=O)c1cn2cc(-c3ccccc3)c(-c3ccc(C=O)cc3)nc2n1 |
| InChI | InChI=1S/C21H15N3O3/c1-27-20(26)18-12-24-11-17(15-5-3-2-4-6-15)19(23-21(24)22-18)16-9-7-14(13-25)8-10-16/h2-13H,1H3 |
| InChIKey | LNIMFIAAZCRDQS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|