C18H12N4O — CID 86630656
4-(6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)benzaldehyde (PubChem CID 86630656) has the molecular formula C18H12N4O and a molecular weight of 300.32 g/mol. Its IUPAC name is 4-(6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)benzaldehyde.
| Compound Name | 4-(6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)benzaldehyde |
|---|---|
| PubChem CID | 86630656 |
| Molecular Formula | C18H12N4O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 4-(6-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-5-yl)benzaldehyde |
| SMILES | O=Cc1ccc(-c2nc3ncnn3cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H12N4O/c23-11-13-6-8-15(9-7-13)17-16(14-4-2-1-3-5-14)10-22-18(21-17)19-12-20-22/h1-12H |
| InChIKey | JAJGIUNOEKWKGJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|