C20H15N3O — CID 86630668
4-(5-methyl-6-phenylimidazo[1,2-a]pyrimidin-7-yl)benzaldehyde (PubChem CID 86630668) has the molecular formula C20H15N3O and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-(5-methyl-6-phenylimidazo[1,2-a]pyrimidin-7-yl)benzaldehyde.
| Compound Name | 4-(5-methyl-6-phenylimidazo[1,2-a]pyrimidin-7-yl)benzaldehyde |
|---|---|
| PubChem CID | 86630668 |
| Molecular Formula | C20H15N3O |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 4-(5-methyl-6-phenylimidazo[1,2-a]pyrimidin-7-yl)benzaldehyde |
| SMILES | Cc1c(-c2ccccc2)c(-c2ccc(C=O)cc2)nc2nccn12 |
| InChI | InChI=1S/C20H15N3O/c1-14-18(16-5-3-2-4-6-16)19(22-20-21-11-12-23(14)20)17-9-7-15(13-24)8-10-17/h2-13H,1H3 |
| InChIKey | VOUJKAHPKFHVHA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|