C19H18F2N4O4 — CID 86705636
11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-ethyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione (PubChem CID 86705636) has the molecular formula C19H18F2N4O4 and a molecular weight of 404.37 g/mol. Its IUPAC name is 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-ethyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione.
| Compound Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-ethyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione |
|---|---|
| PubChem CID | 86705636 |
| Molecular Formula | C19H18F2N4O4 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-ethyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione |
| SMILES | CCN1C(=O)N(c2c(F)c(OC)cc(OC)c2F)Cc2cnc3c(c21)CC(=O)N3 |
| InChI | InChI=1S/C19H18F2N4O4/c1-4-24-16-9(7-22-18-10(16)5-13(26)23-18)8-25(19(24)27)17-14(20)11(28-2)6-12(29-3)15(17)21/h6-7H,4-5,8H2,1-3H3,(H,22,23,26) |
| InChIKey | KLJVGMZPVZAMEK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |