C19H27F3N4O3 — CID 86706862
tert-butyl 4-[[6-[(Z)-2-ethoxyethenyl]-2-(trifluoromethyl)pyrimidin-4-yl]amino]piperidine-1-carboxylate (PubChem CID 86706862) has the molecular formula C19H27F3N4O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is tert-butyl 4-[[6-[(Z)-2-ethoxyethenyl]-2-(trifluoromethyl)pyrimidin-4-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-[(Z)-2-ethoxyethenyl]-2-(trifluoromethyl)pyrimidin-4-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86706862 |
| Molecular Formula | C19H27F3N4O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | tert-butyl 4-[[6-[(Z)-2-ethoxyethenyl]-2-(trifluoromethyl)pyrimidin-4-yl]amino]piperidine-1-carboxylate |
| SMILES | CCO/C=C\c1cc(NC2CCN(C(=O)OC(C)(C)C)CC2)nc(C(F)(F)F)n1 |
| InChI | InChI=1S/C19H27F3N4O3/c1-5-28-11-8-14-12-15(25-16(24-14)19(20,21)22)23-13-6-9-26(10-7-13)17(27)29-18(2,3)4/h8,11-13H,5-7,9-10H2,1-4H3,(H,23,24,25)/b11-8- |
| InChIKey | BSCULOSIINGEJP-FLIBITNWSA-N |
| XLogP | 4.31 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|