C28H31F3N6O2S — CID 86707541
tert-butyl N-[(3S)-1-[(1R)-1-[3-(7-ethylsulfanylquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]pyrrolidin-3-yl]carbamate (PubChem CID 86707541) has the molecular formula C28H31F3N6O2S and a molecular weight of 572.66 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[(1R)-1-[3-(7-ethylsulfanylquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[(1R)-1-[3-(7-ethylsulfanylquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86707541 |
| Molecular Formula | C28H31F3N6O2S |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | tert-butyl N-[(3S)-1-[(1R)-1-[3-(7-ethylsulfanylquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCSc1ccc2ccc(-c3nnc4ccc([C@@H](N5CC[C@H](NC(=O)OC(C)(C)C)C5)C(F)(F)F)cn34)nc2c1 |
| InChI | InChI=1S/C28H31F3N6O2S/c1-5-40-20-9-6-17-7-10-21(33-22(17)14-20)25-35-34-23-11-8-18(15-37(23)25)24(28(29,30)31)36-13-12-19(16-36)32-26(38)39-27(2,3)4/h6-11,14-15,19,24H,5,12-13,16H2,1-4H3,(H,32,38)/t19-,24+/m0/s1 |
| InChIKey | WBWYRRHRPYEPGJ-YADARESESA-N |
| XLogP | 6.26 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |