C26H25F3N6O3 — CID 70984024
[(3R)-1-[1-[3-[8-(cyclopropylmethoxy)quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]pyrrolidin-3-yl]carbamic acid (PubChem CID 70984024) has the molecular formula C26H25F3N6O3 and a molecular weight of 526.52 g/mol. Its IUPAC name is [(3R)-1-[1-[3-[8-(cyclopropylmethoxy)quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]pyrrolidin-3-yl]carbamic acid.
| Compound Name | [(3R)-1-[1-[3-[8-(cyclopropylmethoxy)quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 70984024 |
| Molecular Formula | C26H25F3N6O3 |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | [(3R)-1-[1-[3-[8-(cyclopropylmethoxy)quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-2,2,2-trifluoroethyl]pyrrolidin-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1CCN(C(c2ccc3nnc(-c4ccc5cccc(OCC6CC6)c5n4)n3c2)C(F)(F)F)C1 |
| InChI | InChI=1S/C26H25F3N6O3/c27-26(28,29)23(34-11-10-18(13-34)30-25(36)37)17-7-9-21-32-33-24(35(21)12-17)19-8-6-16-2-1-3-20(22(16)31-19)38-14-15-4-5-15/h1-3,6-9,12,15,18,23,30H,4-5,10-11,13-14H2,(H,36,37)/t18-,23?/m1/s1 |
| InChIKey | PUHVMVAHQNYKLQ-FKSKYRLFSA-N |
| XLogP | 4.68 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |