C23H25Cl2F3N6O2 — CID 86707530
2-[2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]oxyethanol;dihydrochloride (PubChem CID 86707530) has the molecular formula C23H25Cl2F3N6O2 and a molecular weight of 545.39 g/mol. Its IUPAC name is 2-[2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]oxyethanol;dihydrochloride.
| Compound Name | 2-[2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]oxyethanol;dihydrochloride |
|---|---|
| PubChem CID | 86707530 |
| Molecular Formula | C23H25Cl2F3N6O2 |
| Molecular Weight | 545.39 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | 2-[2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]oxyethanol;dihydrochloride |
| SMILES | Cl.Cl.N[C@H]1CCN([C@H](c2ccc3nnc(-c4ccc5cccc(OCCO)c5n4)n3c2)C(F)(F)F)C1 |
| InChI | InChI=1S/C23H23F3N6O2.2ClH/c24-23(25,26)21(31-9-8-16(27)13-31)15-5-7-19-29-30-22(32(19)12-15)17-6-4-14-2-1-3-18(20(14)28-17)34-11-10-33;;/h1-7,12,16,21,33H,8-11,13,27H2;2*1H/t16-,21+;;/m0../s1 |
| InChIKey | IIAWAVKTLQITJJ-GRTIZPKUSA-N |
| XLogP | 3.80 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |