C24H24F4N6O2 — CID 142767735
(2R)-2-[2-[6-[(1R)-1-[(3R)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-6-fluoroquinolin-8-yl]oxypropan-1-ol (PubChem CID 142767735) has the molecular formula C24H24F4N6O2 and a molecular weight of 504.49 g/mol. Its IUPAC name is (2R)-2-[2-[6-[(1R)-1-[(3R)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-6-fluoroquinolin-8-yl]oxypropan-1-ol.
| Compound Name | (2R)-2-[2-[6-[(1R)-1-[(3R)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-6-fluoroquinolin-8-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 142767735 |
| Molecular Formula | C24H24F4N6O2 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | (2R)-2-[2-[6-[(1R)-1-[(3R)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]-6-fluoroquinolin-8-yl]oxypropan-1-ol |
| SMILES | C[C@H](CO)Oc1cc(F)cc2ccc(-c3nnc4ccc([C@@H](N5CC[C@@H](N)C5)C(F)(F)F)cn34)nc12 |
| InChI | InChI=1S/C24H24F4N6O2/c1-13(12-35)36-19-9-16(25)8-14-2-4-18(30-21(14)19)23-32-31-20-5-3-15(10-34(20)23)22(24(26,27)28)33-7-6-17(29)11-33/h2-5,8-10,13,17,22,35H,6-7,11-12,29H2,1H3/t13-,17-,22-/m1/s1 |
| InChIKey | APGIUBFXOWTGJL-NYFKNOIKSA-N |
| XLogP | 3.48 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |