C28H31F3N6O2 — CID 123275107
2-[2-[6-[1-[3-(cyclopropylmethylamino)pyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]oxypropan-1-ol (PubChem CID 123275107) has the molecular formula C28H31F3N6O2 and a molecular weight of 540.59 g/mol. Its IUPAC name is 2-[2-[6-[1-[3-(cyclopropylmethylamino)pyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]oxypropan-1-ol.
| Compound Name | 2-[2-[6-[1-[3-(cyclopropylmethylamino)pyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 123275107 |
| Molecular Formula | C28H31F3N6O2 |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 2-[2-[6-[1-[3-(cyclopropylmethylamino)pyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinolin-8-yl]oxypropan-1-ol |
| SMILES | CC(CO)Oc1cccc2ccc(-c3nnc4ccc(C(N5CCC(NCC6CC6)C5)C(F)(F)F)cn34)nc12 |
| InChI | InChI=1S/C28H31F3N6O2/c1-17(16-38)39-23-4-2-3-19-7-9-22(33-25(19)23)27-35-34-24-10-8-20(14-37(24)27)26(28(29,30)31)36-12-11-21(15-36)32-13-18-5-6-18/h2-4,7-10,14,17-18,21,26,32,38H,5-6,11-13,15-16H2,1H3 |
| InChIKey | QLXOJGLJKVTIIM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |