C22H18F6N6O — CID 89182271
(3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[8-(trifluoromethoxy)quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine (PubChem CID 89182271) has the molecular formula C22H18F6N6O and a molecular weight of 496.42 g/mol. Its IUPAC name is (3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[8-(trifluoromethoxy)quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine.
| Compound Name | (3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[8-(trifluoromethoxy)quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 89182271 |
| Molecular Formula | C22H18F6N6O |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | (3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[8-(trifluoromethoxy)quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine |
| SMILES | N[C@H]1CCN([C@H](c2ccc3nnc(-c4ccc5cccc(OC(F)(F)F)c5n4)n3c2)C(F)(F)F)C1 |
| InChI | InChI=1S/C22H18F6N6O/c23-21(24,25)19(33-9-8-14(29)11-33)13-5-7-17-31-32-20(34(17)10-13)15-6-4-12-2-1-3-16(18(12)30-15)35-22(26,27)28/h1-7,10,14,19H,8-9,11,29H2/t14-,19+/m0/s1 |
| InChIKey | YUGZXKAFQSXLKW-IFXJQAMLSA-N |
| XLogP | 4.48 |
| TPSA | 81.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |