C25H27F3N6O2 — CID 70984768
(3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[7-(2-methoxyethoxy)-8-methylquinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine (PubChem CID 70984768) has the molecular formula C25H27F3N6O2 and a molecular weight of 500.53 g/mol. Its IUPAC name is (3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[7-(2-methoxyethoxy)-8-methylquinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine.
| Compound Name | (3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[7-(2-methoxyethoxy)-8-methylquinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 70984768 |
| Molecular Formula | C25H27F3N6O2 |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | (3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[7-(2-methoxyethoxy)-8-methylquinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine |
| SMILES | COCCOc1ccc2ccc(-c3nnc4ccc([C@@H](N5CC[C@H](N)C5)C(F)(F)F)cn34)nc2c1C |
| InChI | InChI=1S/C25H27F3N6O2/c1-15-20(36-12-11-35-2)7-4-16-3-6-19(30-22(15)16)24-32-31-21-8-5-17(13-34(21)24)23(25(26,27)28)33-10-9-18(29)14-33/h3-8,13,18,23H,9-12,14,29H2,1-2H3/t18-,23+/m0/s1 |
| InChIKey | VPLCGRMLXHJFBJ-FDDCHVKYSA-N |
| XLogP | 3.91 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|