C25H26F4N6O2 — CID 71004992
(3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[6-fluoro-7-[(2S)-2-methoxypropoxy]quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine (PubChem CID 71004992) has the molecular formula C25H26F4N6O2 and a molecular weight of 518.52 g/mol. Its IUPAC name is (3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[6-fluoro-7-[(2S)-2-methoxypropoxy]quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine.
| Compound Name | (3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[6-fluoro-7-[(2S)-2-methoxypropoxy]quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 71004992 |
| Molecular Formula | C25H26F4N6O2 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | (3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[6-fluoro-7-[(2S)-2-methoxypropoxy]quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine |
| SMILES | CO[C@@H](C)COc1cc2nc(-c3nnc4ccc([C@@H](N5CC[C@H](N)C5)C(F)(F)F)cn34)ccc2cc1F |
| InChI | InChI=1S/C25H26F4N6O2/c1-14(36-2)13-37-21-10-20-15(9-18(21)26)3-5-19(31-20)24-33-32-22-6-4-16(11-35(22)24)23(25(27,28)29)34-8-7-17(30)12-34/h3-6,9-11,14,17,23H,7-8,12-13,30H2,1-2H3/t14-,17-,23+/m0/s1 |
| InChIKey | DGLDQWPVLNUYJN-XBCBRRGRSA-N |
| XLogP | 4.13 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |