C25H25ClF4N6O2 — CID 148881771
(3R,4S)-4-[(2R)-2-chloropropoxy]-1-[(1R)-2,2,2-trifluoro-1-[3-(6-fluoro-7-methoxyquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine (PubChem CID 148881771) has the molecular formula C25H25ClF4N6O2 and a molecular weight of 552.96 g/mol. Its IUPAC name is (3R,4S)-4-[(2R)-2-chloropropoxy]-1-[(1R)-2,2,2-trifluoro-1-[3-(6-fluoro-7-methoxyquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine.
| Compound Name | (3R,4S)-4-[(2R)-2-chloropropoxy]-1-[(1R)-2,2,2-trifluoro-1-[3-(6-fluoro-7-methoxyquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 148881771 |
| Molecular Formula | C25H25ClF4N6O2 |
| Molecular Weight | 552.96 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | (3R,4S)-4-[(2R)-2-chloropropoxy]-1-[(1R)-2,2,2-trifluoro-1-[3-(6-fluoro-7-methoxyquinolin-2-yl)-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine |
| SMILES | COc1cc2nc(-c3nnc4ccc([C@@H](N5C[C@@H](N)[C@@H](OC[C@@H](C)Cl)C5)C(F)(F)F)cn34)ccc2cc1F |
| InChI | InChI=1S/C25H25ClF4N6O2/c1-13(26)12-38-21-11-35(10-17(21)31)23(25(28,29)30)15-4-6-22-33-34-24(36(22)9-15)18-5-3-14-7-16(27)20(37-2)8-19(14)32-18/h3-9,13,17,21,23H,10-12,31H2,1-2H3/t13-,17-,21+,23-/m1/s1 |
| InChIKey | PDFIEQJFROQYAQ-NSUVOTPGSA-N |
| XLogP | 4.35 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.96 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|