C26H29F3N6O4 — CID 118510373
formic acid;(3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[8-[(2R)-2-methoxypropoxy]quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine (PubChem CID 118510373) has the molecular formula C26H29F3N6O4 and a molecular weight of 546.55 g/mol. Its IUPAC name is formic acid;(3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[8-[(2R)-2-methoxypropoxy]quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine.
| Compound Name | formic acid;(3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[8-[(2R)-2-methoxypropoxy]quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 118510373 |
| Molecular Formula | C26H29F3N6O4 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | formic acid;(3S)-1-[(1R)-2,2,2-trifluoro-1-[3-[8-[(2R)-2-methoxypropoxy]quinolin-2-yl]-[1,2,4]triazolo[4,3-a]pyridin-6-yl]ethyl]pyrrolidin-3-amine |
| SMILES | CO[C@H](C)COc1cccc2ccc(-c3nnc4ccc([C@@H](N5CC[C@H](N)C5)C(F)(F)F)cn34)nc12.O=CO |
| InChI | InChI=1S/C25H27F3N6O2.CH2O2/c1-15(35-2)14-36-20-5-3-4-16-6-8-19(30-22(16)20)24-32-31-21-9-7-17(12-34(21)24)23(25(26,27)28)33-11-10-18(29)13-33;2-1-3/h3-9,12,15,18,23H,10-11,13-14,29H2,1-2H3;1H,(H,2,3)/t15-,18+,23-;/m1./s1 |
| InChIKey | BLTRWIYWIWEOFB-WQRIDZCJSA-N |
| XLogP | 3.70 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|