C22H18F3N7 — CID 71004784
2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinoline-7-carbonitrile (PubChem CID 71004784) has the molecular formula C22H18F3N7 and a molecular weight of 437.43 g/mol. Its IUPAC name is 2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinoline-7-carbonitrile.
| Compound Name | 2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinoline-7-carbonitrile |
|---|---|
| PubChem CID | 71004784 |
| Molecular Formula | C22H18F3N7 |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-[6-[(1R)-1-[(3S)-3-aminopyrrolidin-1-yl]-2,2,2-trifluoroethyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]quinoline-7-carbonitrile |
| SMILES | N#Cc1ccc2ccc(-c3nnc4ccc([C@@H](N5CC[C@H](N)C5)C(F)(F)F)cn34)nc2c1 |
| InChI | InChI=1S/C22H18F3N7/c23-22(24,25)20(31-8-7-16(27)12-31)15-4-6-19-29-30-21(32(19)11-15)17-5-3-14-2-1-13(10-26)9-18(14)28-17/h1-6,9,11,16,20H,7-8,12,27H2/t16-,20+/m0/s1 |
| InChIKey | GXPYQXDAMJDPDT-OXJNMPFZSA-N |
| XLogP | 3.45 |
| TPSA | 96.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |