C11H26ClNO5 — CID 86709254
2,3-dihydroxypropyl-ethyl-[2-(2-hydroxyethoxy)ethyl]-(2-hydroxyethyl)azanium chloride (PubChem CID 86709254) has the molecular formula C11H26ClNO5 and a molecular weight of 287.78 g/mol. Its IUPAC name is 2,3-dihydroxypropyl-ethyl-[2-(2-hydroxyethoxy)ethyl]-(2-hydroxyethyl)azanium chloride.
| Compound Name | 2,3-dihydroxypropyl-ethyl-[2-(2-hydroxyethoxy)ethyl]-(2-hydroxyethyl)azanium chloride |
|---|---|
| PubChem CID | 86709254 |
| Molecular Formula | C11H26ClNO5 |
| Molecular Weight | 287.78 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2,3-dihydroxypropyl-ethyl-[2-(2-hydroxyethoxy)ethyl]-(2-hydroxyethyl)azanium chloride |
| SMILES | CC[N+](CCO)(CCOCCO)CC(O)CO.[Cl-] |
| InChI | InChI=1S/C11H26NO5.ClH/c1-2-12(3-5-13,9-11(16)10-15)4-7-17-8-6-14;/h11,13-16H,2-10H2,1H3;1H/q+1;/p-1 |
| InChIKey | VOXXIURXHRYXAM-UHFFFAOYSA-M |
| XLogP | -4.82 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.78 |
| LogP ≤ 5 | -4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|