C10H24ClNO4 — CID 86709256
2,3-dihydroxypropyl-[2-(2-hydroxyethoxy)propyl]-dimethylazanium chloride (PubChem CID 86709256) has the molecular formula C10H24ClNO4 and a molecular weight of 257.76 g/mol. Its IUPAC name is 2,3-dihydroxypropyl-[2-(2-hydroxyethoxy)propyl]-dimethylazanium chloride.
| Compound Name | 2,3-dihydroxypropyl-[2-(2-hydroxyethoxy)propyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 86709256 |
| Molecular Formula | C10H24ClNO4 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2,3-dihydroxypropyl-[2-(2-hydroxyethoxy)propyl]-dimethylazanium chloride |
| SMILES | CC(C[N+](C)(C)CC(O)CO)OCCO.[Cl-] |
| InChI | InChI=1S/C10H24NO4.ClH/c1-9(15-5-4-12)6-11(2,3)7-10(14)8-13;/h9-10,12-14H,4-8H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | JDTCLLVOCMRUJW-UHFFFAOYSA-M |
| XLogP | -4.18 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | -4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|