C12H15N3O6S2 — CID 86714639
2-ethoxycarbonyl-6-[methylsulfonylmethyl(sulfino)amino]imidazo[1,2-a]pyridine (PubChem CID 86714639) has the molecular formula C12H15N3O6S2 and a molecular weight of 361.40 g/mol. Its IUPAC name is 2-ethoxycarbonyl-6-[methylsulfonylmethyl(sulfino)amino]imidazo[1,2-a]pyridine.
| Compound Name | 2-ethoxycarbonyl-6-[methylsulfonylmethyl(sulfino)amino]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 86714639 |
| Molecular Formula | C12H15N3O6S2 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 2-ethoxycarbonyl-6-[methylsulfonylmethyl(sulfino)amino]imidazo[1,2-a]pyridine |
| SMILES | CCOC(=O)c1cn2cc(N(CS(C)(=O)=O)S(=O)O)ccc2n1 |
| InChI | InChI=1S/C12H15N3O6S2/c1-3-21-12(16)10-7-14-6-9(4-5-11(14)13-10)15(22(17)18)8-23(2,19)20/h4-7H,3,8H2,1-2H3,(H,17,18) |
| InChIKey | LIBHFWSWBSOJAG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|