C19H17F5N2O — CID 86716269
N-[[4,4-difluoro-1-(6-fluoro-3-pyridinyl)cyclohexyl]methyl]-2,5-difluorobenzamide (PubChem CID 86716269) has the molecular formula C19H17F5N2O and a molecular weight of 384.35 g/mol. Its IUPAC name is N-[[4,4-difluoro-1-(6-fluoro-3-pyridinyl)cyclohexyl]methyl]-2,5-difluorobenzamide.
| Compound Name | N-[[4,4-difluoro-1-(6-fluoro-3-pyridinyl)cyclohexyl]methyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 86716269 |
| Molecular Formula | C19H17F5N2O |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-[[4,4-difluoro-1-(6-fluoro-3-pyridinyl)cyclohexyl]methyl]-2,5-difluorobenzamide |
| SMILES | O=C(NCC1(c2ccc(F)nc2)CCC(F)(F)CC1)c1cc(F)ccc1F |
| InChI | InChI=1S/C19H17F5N2O/c20-13-2-3-15(21)14(9-13)17(27)26-11-18(5-7-19(23,24)8-6-18)12-1-4-16(22)25-10-12/h1-4,9-10H,5-8,11H2,(H,26,27) |
| InChIKey | QHQDQDLSKSNOLG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|