C11H13ClF2N4O4S — CID 86716594
(1R,2S,4R,5R,6R)-2-amino-4-[[5-(difluoromethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride (PubChem CID 86716594) has the molecular formula C11H13ClF2N4O4S and a molecular weight of 370.77 g/mol. Its IUPAC name is (1R,2S,4R,5R,6R)-2-amino-4-[[5-(difluoromethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride.
| Compound Name | (1R,2S,4R,5R,6R)-2-amino-4-[[5-(difluoromethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 86716594 |
| Molecular Formula | C11H13ClF2N4O4S |
| Molecular Weight | 370.77 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | (1R,2S,4R,5R,6R)-2-amino-4-[[5-(difluoromethyl)-1H-1,2,4-triazol-3-yl]sulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylic acid;hydrochloride |
| SMILES | Cl.N[C@@]1(C(=O)O)C[C@@H](Sc2n[nH]c(C(F)F)n2)[C@H]2[C@H](C(=O)O)[C@H]21 |
| InChI | InChI=1S/C11H12F2N4O4S.ClH/c12-6(13)7-15-10(17-16-7)22-2-1-11(14,9(20)21)5-3(2)4(5)8(18)19;/h2-6H,1,14H2,(H,18,19)(H,20,21)(H,15,16,17);1H/t2-,3+,4+,5+,11+;/m1./s1 |
| InChIKey | ZOZLUXKDWMTXCE-XHEPXMHESA-N |
| XLogP | 0.76 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.77 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |