C19H28N2O4 — CID 86734590
1-[4-(2-butoxy-2-isocyanatoethenyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 86734590) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 1-[4-(2-butoxy-2-isocyanatoethenyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-[4-(2-butoxy-2-isocyanatoethenyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 86734590 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-[4-(2-butoxy-2-isocyanatoethenyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CCCCOC(=Cc1ccc(OCC(O)CNC(C)C)cc1)N=C=O |
| InChI | InChI=1S/C19H28N2O4/c1-4-5-10-24-19(21-14-22)11-16-6-8-18(9-7-16)25-13-17(23)12-20-15(2)3/h6-9,11,15,17,20,23H,4-5,10,12-13H2,1-3H3 |
| InChIKey | DUIKHQDDVHVSOV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|