C28H27Cl4FN2O — CID 86734655
1-[2-butoxy-2-(2,4-dichlorophenyl)ethyl]-3-[(4-chlorophenyl)-(4-fluorophenyl)methyl]imidazol-1-ium chloride (PubChem CID 86734655) has the molecular formula C28H27Cl4FN2O and a molecular weight of 568.35 g/mol. Its IUPAC name is 1-[2-butoxy-2-(2,4-dichlorophenyl)ethyl]-3-[(4-chlorophenyl)-(4-fluorophenyl)methyl]imidazol-1-ium chloride.
| Compound Name | 1-[2-butoxy-2-(2,4-dichlorophenyl)ethyl]-3-[(4-chlorophenyl)-(4-fluorophenyl)methyl]imidazol-1-ium chloride |
|---|---|
| PubChem CID | 86734655 |
| Molecular Formula | C28H27Cl4FN2O |
| Molecular Weight | 568.35 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | 1-[2-butoxy-2-(2,4-dichlorophenyl)ethyl]-3-[(4-chlorophenyl)-(4-fluorophenyl)methyl]imidazol-1-ium chloride |
| SMILES | CCCCOC(C[n+]1ccn(C(c2ccc(F)cc2)c2ccc(Cl)cc2)c1)c1ccc(Cl)cc1Cl.[Cl-] |
| InChI | InChI=1S/C28H27Cl3FN2O.ClH/c1-2-3-16-35-27(25-13-10-23(30)17-26(25)31)18-33-14-15-34(19-33)28(20-4-8-22(29)9-5-20)21-6-11-24(32)12-7-21;/h4-15,17,19,27-28H,2-3,16,18H2,1H3;1H/q+1;/p-1 |
| InChIKey | INYJVGXGBYBTEU-UHFFFAOYSA-M |
| XLogP | 5.07 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|