C24H16ClN3O7 — CID 86737751
N-(2-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-3-(4-methoxy-3-nitrophenyl)-3-oxopropanamide (PubChem CID 86737751) has the molecular formula C24H16ClN3O7 and a molecular weight of 493.86 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-3-(4-methoxy-3-nitrophenyl)-3-oxopropanamide.
| Compound Name | N-(2-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-3-(4-methoxy-3-nitrophenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 86737751 |
| Molecular Formula | C24H16ClN3O7 |
| Molecular Weight | 493.86 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | N-(2-chlorophenyl)-2-(1,3-dioxoisoindol-2-yl)-3-(4-methoxy-3-nitrophenyl)-3-oxopropanamide |
| SMILES | COc1ccc(C(=O)C(C(=O)Nc2ccccc2Cl)N2C(=O)c3ccccc3C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H16ClN3O7/c1-35-19-11-10-13(12-18(19)28(33)34)21(29)20(22(30)26-17-9-5-4-8-16(17)25)27-23(31)14-6-2-3-7-15(14)24(27)32/h2-12,20H,1H3,(H,26,30) |
| InChIKey | NJXHVIDODQEIIO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.86 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|