C12H11NO6-2 — CID 86740992
(2S)-2-[3-(furan-2-yl)prop-2-enoylamino]pentanedioate (PubChem CID 86740992) has the molecular formula C12H11NO6-2 and a molecular weight of 265.22 g/mol. Its IUPAC name is (2S)-2-[3-(furan-2-yl)prop-2-enoylamino]pentanedioate.
| Compound Name | (2S)-2-[3-(furan-2-yl)prop-2-enoylamino]pentanedioate |
|---|---|
| PubChem CID | 86740992 |
| Molecular Formula | C12H11NO6-2 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | (2S)-2-[3-(furan-2-yl)prop-2-enoylamino]pentanedioate |
| SMILES | O=C([O-])CC[C@H](NC(=O)C=Cc1ccco1)C(=O)[O-] |
| InChI | InChI=1S/C12H13NO6/c14-10(5-3-8-2-1-7-19-8)13-9(12(17)18)4-6-11(15)16/h1-3,5,7,9H,4,6H2,(H,13,14)(H,15,16)(H,17,18)/p-2/t9-/m0/s1 |
| InChIKey | QATSOYORWOICJB-VIFPVBQESA-L |
| XLogP | -1.94 |
| TPSA | 122.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|