C22H35N3O4 — CID 13421042
2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N'-dipentylpentanediamide (PubChem CID 13421042) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N'-dipentylpentanediamide.
| Compound Name | 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N'-dipentylpentanediamide |
|---|---|
| PubChem CID | 13421042 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-N,N'-dipentylpentanediamide |
| SMILES | CCCCCNC(=O)CCC(NC(=O)/C=C/c1ccco1)C(=O)NCCCCC |
| InChI | InChI=1S/C22H35N3O4/c1-3-5-7-15-23-20(26)14-12-19(22(28)24-16-8-6-4-2)25-21(27)13-11-18-10-9-17-29-18/h9-11,13,17,19H,3-8,12,14-16H2,1-2H3,(H,23,26)(H,24,28)(H,25,27)/b13-11+ |
| InChIKey | LWBQSRWVWHIQAS-ACCUITESSA-N |
| XLogP | 3.17 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|