C11H22N2O3S — CID 86743826
tert-butyl 5-(aminomethyl)-3-ethyl-4-sulfanyl-1,2-oxazolidine-2-carboxylate (PubChem CID 86743826) has the molecular formula C11H22N2O3S and a molecular weight of 262.38 g/mol. Its IUPAC name is tert-butyl 5-(aminomethyl)-3-ethyl-4-sulfanyl-1,2-oxazolidine-2-carboxylate.
| Compound Name | tert-butyl 5-(aminomethyl)-3-ethyl-4-sulfanyl-1,2-oxazolidine-2-carboxylate |
|---|---|
| PubChem CID | 86743826 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | tert-butyl 5-(aminomethyl)-3-ethyl-4-sulfanyl-1,2-oxazolidine-2-carboxylate |
| SMILES | CCC1C(S)C(CN)ON1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H22N2O3S/c1-5-7-9(17)8(6-12)16-13(7)10(14)15-11(2,3)4/h7-9,17H,5-6,12H2,1-4H3 |
| InChIKey | SHWVLRBHUKYNBQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|