C13H21NO5 — CID 44514623
tert-butyl (3S,6S)-6-(acetyloxymethyl)-3-methyl-3,6-dihydrooxazine-2-carboxylate (PubChem CID 44514623) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is tert-butyl (3S,6S)-6-(acetyloxymethyl)-3-methyl-3,6-dihydrooxazine-2-carboxylate.
| Compound Name | tert-butyl (3S,6S)-6-(acetyloxymethyl)-3-methyl-3,6-dihydrooxazine-2-carboxylate |
|---|---|
| PubChem CID | 44514623 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | tert-butyl (3S,6S)-6-(acetyloxymethyl)-3-methyl-3,6-dihydrooxazine-2-carboxylate |
| SMILES | CC(=O)OC[C@@H]1C=C[C@H](C)N(C(=O)OC(C)(C)C)O1 |
| InChI | InChI=1S/C13H21NO5/c1-9-6-7-11(8-17-10(2)15)19-14(9)12(16)18-13(3,4)5/h6-7,9,11H,8H2,1-5H3/t9-,11-/m0/s1 |
| InChIKey | YRQNBEAYDLGGFN-ONGXEEELSA-N |
| XLogP | 2.05 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|