C12H19NO3 — CID 10846823
tert-butyl (1R,5S)-6-oxa-7-azabicyclo[3.2.2]non-8-ene-7-carboxylate (PubChem CID 10846823) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is tert-butyl (1R,5S)-6-oxa-7-azabicyclo[3.2.2]non-8-ene-7-carboxylate.
| Compound Name | tert-butyl (1R,5S)-6-oxa-7-azabicyclo[3.2.2]non-8-ene-7-carboxylate |
|---|---|
| PubChem CID | 10846823 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | tert-butyl (1R,5S)-6-oxa-7-azabicyclo[3.2.2]non-8-ene-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1O[C@@H]2C=C[C@H]1CCC2 |
| InChI | InChI=1S/C12H19NO3/c1-12(2,3)15-11(14)13-9-5-4-6-10(16-13)8-7-9/h7-10H,4-6H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | ZLBKDOWTWJOPME-ZJUUUORDSA-N |
| XLogP | 2.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|