C12H26O6 — CID 143998117
ethane;[(2R,3R)-3-hydroxyoxolan-2-yl]methyl acetate;propane-2,2-diol (PubChem CID 143998117) has the molecular formula C12H26O6 and a molecular weight of 266.33 g/mol. Its IUPAC name is ethane;[(2R,3R)-3-hydroxyoxolan-2-yl]methyl acetate;propane-2,2-diol.
| Compound Name | ethane;[(2R,3R)-3-hydroxyoxolan-2-yl]methyl acetate;propane-2,2-diol |
|---|---|
| PubChem CID | 143998117 |
| Molecular Formula | C12H26O6 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | ethane;[(2R,3R)-3-hydroxyoxolan-2-yl]methyl acetate;propane-2,2-diol |
| SMILES | CC.CC(=O)OC[C@H]1OCC[C@H]1O.CC(C)(O)O |
| InChI | InChI=1S/C7H12O4.C3H8O2.C2H6/c1-5(8)11-4-7-6(9)2-3-10-7;1-3(2,4)5;1-2/h6-7,9H,2-4H2,1H3;4-5H,1-2H3;1-2H3/t6-,7-;;/m1../s1 |
| InChIKey | KLPMEZSGNFHARV-GPJOBVNKSA-N |
| XLogP | 0.43 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|