C16H15NO3 — CID 86746432
4a-benzyl-5-methyl-1,8a-dihydro-3,1-benzoxazine-2,4-dione (PubChem CID 86746432) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 4a-benzyl-5-methyl-1,8a-dihydro-3,1-benzoxazine-2,4-dione.
| Compound Name | 4a-benzyl-5-methyl-1,8a-dihydro-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 86746432 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4a-benzyl-5-methyl-1,8a-dihydro-3,1-benzoxazine-2,4-dione |
| SMILES | CC1=CC=CC2NC(=O)OC(=O)C12Cc1ccccc1 |
| InChI | InChI=1S/C16H15NO3/c1-11-6-5-9-13-16(11,14(18)20-15(19)17-13)10-12-7-3-2-4-8-12/h2-9,13H,10H2,1H3,(H,17,19) |
| InChIKey | IFDSVMPTSBYNCX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|