About 2-(4-nitrophenyl)ethyl 1-methyl-1H-imidazol-1-ium-2-carboxylate chloride
2-(4-nitrophenyl)ethyl 1-methyl-1H-imidazol-1-ium-2-carboxylate chloride (PubChem CID 86751123) has the molecular formula C13H14ClN3O4
and a molecular weight of 311.73 g/mol. Its IUPAC name is 2-(4-nitrophenyl)ethyl 1-methyl-1H-imidazol-1-ium-2-carboxylate chloride.
Molecular Properties
| Compound Name | 2-(4-nitrophenyl)ethyl 1-methyl-1H-imidazol-1-ium-2-carboxylate chloride |
| PubChem CID | 86751123 |
| Molecular Formula | C13H14ClN3O4 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-(4-nitrophenyl)ethyl 1-methyl-1H-imidazol-1-ium-2-carboxylate chloride |
| SMILES | C[NH+]1C=CN=C1C(=O)OCCc1ccc([N+](=O)[O-])cc1.[Cl-] |
| InChI | InChI=1S/C13H13N3O4.ClH/c1-15-8-7-14-12(15)13(17)20-9-6-10-2-4-11(5-3-10)16(18)19;/h2-5,7-8H,6,9H2,1H3;1H |
| InChIKey | QBSPJSBWEPQKMQ-UHFFFAOYSA-N |
| XLogP | -2.92 |
| TPSA | 86.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-nitrophenyl)ethyl 1-methyl-1H-imidazol-1-ium-2-carboxylate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-nitrophenyl)ethyl 1-methyl-1H-imidazol-1-ium-2-carboxylate chloride?
The IUPAC name of 2-(4-nitrophenyl)ethyl 1-methyl-1H-imidazol-1-ium-2-carboxylate chloride (CID 86751123) is 2-(4-nitrophenyl)ethyl 1-methyl-1H-imidazol-1-ium-2-carboxylate chloride.
What is the SMILES notation for 2-(4-nitrophenyl)ethyl 1-methyl-1H-imidazol-1-ium-2-carboxylate chloride?
The canonical SMILES for 2-(4-nitrophenyl)ethyl 1-methyl-1H-imidazol-1-ium-2-carboxylate chloride is C[NH+]1C=CN=C1C(=O)OCCc1ccc([N+](=O)[O-])cc1.[Cl-].
What is the InChIKey of 2-(4-nitrophenyl)ethyl 1-methyl-1H-imidazol-1-ium-2-carboxylate chloride?
The InChIKey is QBSPJSBWEPQKMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O4.ClH/c1-15-8-7-14-12(15)13(17)20-9-6-10-2-4-11(5-3-10)16(18)19;/h2-5,7-8H,6,9H2,1H3;1H.
What are the key properties of 2-(4-nitrophenyl)ethyl 1-methyl-1H-imidazol-1-ium-2-carboxylate chloride?
2-(4-nitrophenyl)ethyl 1-methyl-1H-imidazol-1-ium-2-carboxylate chloride has a molecular weight of 311.73 g/mol, XLogP of -2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitrophenyl)ethyl 1-methyl-1H-imidazol-1-ium-2-carboxylate chloride is sourced from PubChem (CID 86751123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).