C11H9O4S- — CID 86759181
1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate (PubChem CID 86759181) has the molecular formula C11H9O4S- and a molecular weight of 237.26 g/mol. Its IUPAC name is 1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate.
| Compound Name | 1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate |
|---|---|
| PubChem CID | 86759181 |
| Molecular Formula | C11H9O4S- |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 1,1-dioxo-2,3-dihydro-1λ6-benzothiepine-4-carboxylate |
| SMILES | O=C([O-])C1=Cc2ccccc2S(=O)(=O)CC1 |
| InChI | InChI=1S/C11H10O4S/c12-11(13)9-5-6-16(14,15)10-4-2-1-3-8(10)7-9/h1-4,7H,5-6H2,(H,12,13)/p-1 |
| InChIKey | VNMAQWUTHSXENA-UHFFFAOYSA-M |
| XLogP | -0.00 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |