C22H18BrN3O5S2 — CID 86762816
N-[3-(3-bromophenyl)sulfonylphenyl]-6-(methanesulfonamido)-1H-indole-2-carboxamide (PubChem CID 86762816) has the molecular formula C22H18BrN3O5S2 and a molecular weight of 548.44 g/mol. Its IUPAC name is N-[3-(3-bromophenyl)sulfonylphenyl]-6-(methanesulfonamido)-1H-indole-2-carboxamide.
| Compound Name | N-[3-(3-bromophenyl)sulfonylphenyl]-6-(methanesulfonamido)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 86762816 |
| Molecular Formula | C22H18BrN3O5S2 |
| Molecular Weight | 548.44 g/mol |
| Exact Mass | 546.99 |
| IUPAC Name | N-[3-(3-bromophenyl)sulfonylphenyl]-6-(methanesulfonamido)-1H-indole-2-carboxamide |
| SMILES | CS(=O)(=O)Nc1ccc2cc(C(=O)Nc3cccc(S(=O)(=O)c4cccc(Br)c4)c3)[nH]c2c1 |
| InChI | InChI=1S/C22H18BrN3O5S2/c1-32(28,29)26-17-9-8-14-10-21(25-20(14)13-17)22(27)24-16-5-3-7-19(12-16)33(30,31)18-6-2-4-15(23)11-18/h2-13,25-26H,1H3,(H,24,27) |
| InChIKey | SNSJRCJZTUZWER-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |