C22H18FN3O5 — CID 86766013
3-hydroxypropyl (5Z)-2-(4-fluorophenyl)imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate (PubChem CID 86766013) has the molecular formula C22H18FN3O5 and a molecular weight of 423.40 g/mol. Its IUPAC name is 3-hydroxypropyl (5Z)-2-(4-fluorophenyl)imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate.
| Compound Name | 3-hydroxypropyl (5Z)-2-(4-fluorophenyl)imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate |
|---|---|
| PubChem CID | 86766013 |
| Molecular Formula | C22H18FN3O5 |
| Molecular Weight | 423.40 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 3-hydroxypropyl (5Z)-2-(4-fluorophenyl)imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate |
| SMILES | O=C(OCCCO)C1C(=O)/C(=C/c2c[nH]c3ncccc23)O/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C22H18FN3O5/c23-14-4-6-15(7-5-14)26-21-18(22(29)30-10-2-9-27)19(28)17(31-21)11-13-12-25-20-16(13)3-1-8-24-20/h1,3-8,11-12,18,27H,2,9-10H2,(H,24,25)/b17-11-,26-21- |
| InChIKey | JQXHDICOMOIFEC-ZFHJPSSFSA-N |
| XLogP | 2.91 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|