C19H24N6 — CID 86772923
N-[(1-benzylpyrazol-4-yl)methyl]-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine (PubChem CID 86772923) has the molecular formula C19H24N6 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[(1-benzylpyrazol-4-yl)methyl]-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine.
| Compound Name | N-[(1-benzylpyrazol-4-yl)methyl]-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
|---|---|
| PubChem CID | 86772923 |
| Molecular Formula | C19H24N6 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | N-[(1-benzylpyrazol-4-yl)methyl]-3-ethyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
| SMILES | CCc1nnc2n1CC(NCc1cnn(Cc3ccccc3)c1)CC2 |
| InChI | InChI=1S/C19H24N6/c1-2-18-22-23-19-9-8-17(14-25(18)19)20-10-16-11-21-24(13-16)12-15-6-4-3-5-7-15/h3-7,11,13,17,20H,2,8-10,12,14H2,1H3 |
| InChIKey | AMFWOKCSCFLACO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |