C10H13ClN4 — CID 86775451
1-phenyl-N-(2H-triazol-4-ylmethyl)methanamine;hydrochloride (PubChem CID 86775451) has the molecular formula C10H13ClN4 and a molecular weight of 224.70 g/mol. Its IUPAC name is 1-phenyl-N-(2H-triazol-4-ylmethyl)methanamine;hydrochloride.
| Compound Name | 1-phenyl-N-(2H-triazol-4-ylmethyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 86775451 |
| Molecular Formula | C10H13ClN4 |
| Molecular Weight | 224.70 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1-phenyl-N-(2H-triazol-4-ylmethyl)methanamine;hydrochloride |
| SMILES | Cl.c1ccc(CNCc2cn[nH]n2)cc1 |
| InChI | InChI=1S/C10H12N4.ClH/c1-2-4-9(5-3-1)6-11-7-10-8-12-14-13-10;/h1-5,8,11H,6-7H2,(H,12,13,14);1H |
| InChIKey | HHZDPOYRDCRIRR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.70 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |