C7H12N4O2S — CID 86775472
1-(1H-pyrazol-5-ylsulfonyl)piperazine (PubChem CID 86775472) has the molecular formula C7H12N4O2S and a molecular weight of 216.27 g/mol. Its IUPAC name is 1-(1H-pyrazol-5-ylsulfonyl)piperazine.
| Compound Name | 1-(1H-pyrazol-5-ylsulfonyl)piperazine |
|---|---|
| PubChem CID | 86775472 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 1-(1H-pyrazol-5-ylsulfonyl)piperazine |
| SMILES | O=S(=O)(c1ccn[nH]1)N1CCNCC1 |
| InChI | InChI=1S/C7H12N4O2S/c12-14(13,7-1-2-9-10-7)11-5-3-8-4-6-11/h1-2,8H,3-6H2,(H,9,10) |
| InChIKey | TVHHIFDXIAVPIH-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |