C11H9F2N5O3 — CID 86780545
2-[4-(2,6-difluoro-4-nitroanilino)pyrazol-1-yl]acetamide (PubChem CID 86780545) has the molecular formula C11H9F2N5O3 and a molecular weight of 297.22 g/mol. Its IUPAC name is 2-[4-(2,6-difluoro-4-nitroanilino)pyrazol-1-yl]acetamide.
| Compound Name | 2-[4-(2,6-difluoro-4-nitroanilino)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 86780545 |
| Molecular Formula | C11H9F2N5O3 |
| Molecular Weight | 297.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-[4-(2,6-difluoro-4-nitroanilino)pyrazol-1-yl]acetamide |
| SMILES | NC(=O)Cn1cc(Nc2c(F)cc([N+](=O)[O-])cc2F)cn1 |
| InChI | InChI=1S/C11H9F2N5O3/c12-8-1-7(18(20)21)2-9(13)11(8)16-6-3-15-17(4-6)5-10(14)19/h1-4,16H,5H2,(H2,14,19) |
| InChIKey | ODFMMBSCJKNOCY-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|