C12H22F3IN4O2S — CID 86781178
1-ethyl-2-prop-2-enyl-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]guanidine;hydroiodide (PubChem CID 86781178) has the molecular formula C12H22F3IN4O2S and a molecular weight of 470.30 g/mol. Its IUPAC name is 1-ethyl-2-prop-2-enyl-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-prop-2-enyl-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 86781178 |
| Molecular Formula | C12H22F3IN4O2S |
| Molecular Weight | 470.30 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 1-ethyl-2-prop-2-enyl-3-[1-(trifluoromethylsulfonyl)piperidin-4-yl]guanidine;hydroiodide |
| SMILES | C=CC/N=C(\NCC)NC1CCN(S(=O)(=O)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C12H21F3N4O2S.HI/c1-3-7-17-11(16-4-2)18-10-5-8-19(9-6-10)22(20,21)12(13,14)15;/h3,10H,1,4-9H2,2H3,(H2,16,17,18);1H |
| InChIKey | ZXWZNPOCVNTNAH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|