C15H20ClNO2 — CID 86787500
[(1R,4S)-4-[1-(5-chloro-2-methoxyphenyl)ethylamino]cyclopent-2-en-1-yl]methanol (PubChem CID 86787500) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is [(1R,4S)-4-[1-(5-chloro-2-methoxyphenyl)ethylamino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[1-(5-chloro-2-methoxyphenyl)ethylamino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 86787500 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | [(1R,4S)-4-[1-(5-chloro-2-methoxyphenyl)ethylamino]cyclopent-2-en-1-yl]methanol |
| SMILES | COc1ccc(Cl)cc1C(C)N[C@@H]1C=C[C@H](CO)C1 |
| InChI | InChI=1S/C15H20ClNO2/c1-10(17-13-5-3-11(7-13)9-18)14-8-12(16)4-6-15(14)19-2/h3-6,8,10-11,13,17-18H,7,9H2,1-2H3/t10?,11-,13+/m0/s1 |
| InChIKey | YJOVYPZNURZYIP-QMDRTORHSA-N |
| XLogP | 2.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|