C19H23NO2 — CID 99777354
[(1R,4S)-4-[[(1S)-1-(4-methoxynaphthalen-1-yl)ethyl]amino]cyclopent-2-en-1-yl]methanol (PubChem CID 99777354) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is [(1R,4S)-4-[[(1S)-1-(4-methoxynaphthalen-1-yl)ethyl]amino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[[(1S)-1-(4-methoxynaphthalen-1-yl)ethyl]amino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 99777354 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | [(1R,4S)-4-[[(1S)-1-(4-methoxynaphthalen-1-yl)ethyl]amino]cyclopent-2-en-1-yl]methanol |
| SMILES | COc1ccc([C@H](C)N[C@@H]2C=C[C@H](CO)C2)c2ccccc12 |
| InChI | InChI=1S/C19H23NO2/c1-13(20-15-8-7-14(11-15)12-21)16-9-10-19(22-2)18-6-4-3-5-17(16)18/h3-10,13-15,20-21H,11-12H2,1-2H3/t13-,14-,15+/m0/s1 |
| InChIKey | IJQUOXCPMARBHK-SOUVJXGZSA-N |
| XLogP | 3.44 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|