C14H17F2NO — CID 86787513
[(1R,4S)-4-[1-(2,3-difluorophenyl)ethylamino]cyclopent-2-en-1-yl]methanol (PubChem CID 86787513) has the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. Its IUPAC name is [(1R,4S)-4-[1-(2,3-difluorophenyl)ethylamino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[1-(2,3-difluorophenyl)ethylamino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 86787513 |
| Molecular Formula | C14H17F2NO |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | [(1R,4S)-4-[1-(2,3-difluorophenyl)ethylamino]cyclopent-2-en-1-yl]methanol |
| SMILES | CC(N[C@@H]1C=C[C@H](CO)C1)c1cccc(F)c1F |
| InChI | InChI=1S/C14H17F2NO/c1-9(12-3-2-4-13(15)14(12)16)17-11-6-5-10(7-11)8-18/h2-6,9-11,17-18H,7-8H2,1H3/t9?,10-,11+/m0/s1 |
| InChIKey | CQQYXRJLIGSKRW-QXXIUIOUSA-N |
| XLogP | 2.55 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|