C17H20FN3O — CID 86787511
[(1R,4S)-4-[[(3-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]amino]cyclopent-2-en-1-yl]methanol (PubChem CID 86787511) has the molecular formula C17H20FN3O and a molecular weight of 301.37 g/mol. Its IUPAC name is [(1R,4S)-4-[[(3-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]amino]cyclopent-2-en-1-yl]methanol.
| Compound Name | [(1R,4S)-4-[[(3-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]amino]cyclopent-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 86787511 |
| Molecular Formula | C17H20FN3O |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | [(1R,4S)-4-[[(3-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]amino]cyclopent-2-en-1-yl]methanol |
| SMILES | Cn1cc(C(N[C@@H]2C=C[C@H](CO)C2)c2cccc(F)c2)cn1 |
| InChI | InChI=1S/C17H20FN3O/c1-21-10-14(9-19-21)17(13-3-2-4-15(18)8-13)20-16-6-5-12(7-16)11-22/h2-6,8-10,12,16-17,20,22H,7,11H2,1H3/t12-,16+,17?/m0/s1 |
| InChIKey | QTVQLYSXKRJZPN-SQHWGMCGSA-N |
| XLogP | 2.18 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|