C19H26N2O5 — CID 86788405
3,5-dimethoxy-N-[3-methyl-1-oxo-1-(2-prop-2-ynoxyethylamino)butan-2-yl]benzamide (PubChem CID 86788405) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[3-methyl-1-oxo-1-(2-prop-2-ynoxyethylamino)butan-2-yl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[3-methyl-1-oxo-1-(2-prop-2-ynoxyethylamino)butan-2-yl]benzamide |
|---|---|
| PubChem CID | 86788405 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 3,5-dimethoxy-N-[3-methyl-1-oxo-1-(2-prop-2-ynoxyethylamino)butan-2-yl]benzamide |
| SMILES | C#CCOCCNC(=O)C(NC(=O)c1cc(OC)cc(OC)c1)C(C)C |
| InChI | InChI=1S/C19H26N2O5/c1-6-8-26-9-7-20-19(23)17(13(2)3)21-18(22)14-10-15(24-4)12-16(11-14)25-5/h1,10-13,17H,7-9H2,2-5H3,(H,20,23)(H,21,22) |
| InChIKey | RTQIDAKBFKQFTB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|