C23H22N2O3S — CID 86792151
methyl 2-[(2-benzyl-1,3-thiazole-4-carbonyl)-cyclobutylamino]benzoate (PubChem CID 86792151) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is methyl 2-[(2-benzyl-1,3-thiazole-4-carbonyl)-cyclobutylamino]benzoate.
| Compound Name | methyl 2-[(2-benzyl-1,3-thiazole-4-carbonyl)-cyclobutylamino]benzoate |
|---|---|
| PubChem CID | 86792151 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | methyl 2-[(2-benzyl-1,3-thiazole-4-carbonyl)-cyclobutylamino]benzoate |
| SMILES | COC(=O)c1ccccc1N(C(=O)c1csc(Cc2ccccc2)n1)C1CCC1 |
| InChI | InChI=1S/C23H22N2O3S/c1-28-23(27)18-12-5-6-13-20(18)25(17-10-7-11-17)22(26)19-15-29-21(24-19)14-16-8-3-2-4-9-16/h2-6,8-9,12-13,15,17H,7,10-11,14H2,1H3 |
| InChIKey | IBIHNGPRIPAZOO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |