C16H18F3N3O4 — CID 86792418
2-[5-(2-ethoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 86792418) has the molecular formula C16H18F3N3O4 and a molecular weight of 373.33 g/mol. Its IUPAC name is 2-[5-(2-ethoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[5-(2-ethoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 86792418 |
| Molecular Formula | C16H18F3N3O4 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-[5-(2-ethoxyethoxymethyl)-1,2,4-oxadiazol-3-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCOCCOCc1nc(CC(=O)Nc2cccc(C(F)(F)F)c2)no1 |
| InChI | InChI=1S/C16H18F3N3O4/c1-2-24-6-7-25-10-15-21-13(22-26-15)9-14(23)20-12-5-3-4-11(8-12)16(17,18)19/h3-5,8H,2,6-7,9-10H2,1H3,(H,20,23) |
| InChIKey | OIFASUFVCFBOIU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|