C13H13N5O — CID 86794129
1-methyl-N-(4-methyl-1,2,4-triazol-3-yl)indole-3-carboxamide (PubChem CID 86794129) has the molecular formula C13H13N5O and a molecular weight of 255.28 g/mol. Its IUPAC name is 1-methyl-N-(4-methyl-1,2,4-triazol-3-yl)indole-3-carboxamide.
| Compound Name | 1-methyl-N-(4-methyl-1,2,4-triazol-3-yl)indole-3-carboxamide |
|---|---|
| PubChem CID | 86794129 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-methyl-N-(4-methyl-1,2,4-triazol-3-yl)indole-3-carboxamide |
| SMILES | Cn1cnnc1NC(=O)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C13H13N5O/c1-17-7-10(9-5-3-4-6-11(9)17)12(19)15-13-16-14-8-18(13)2/h3-8H,1-2H3,(H,15,16,19) |
| InChIKey | DHICKODHUPDPIS-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |