C15H19F2N3O4S — CID 8680331
ethyl N-[2-[[4-(difluoromethoxy)phenyl]carbamothioyl-ethylamino]acetyl]carbamate (PubChem CID 8680331) has the molecular formula C15H19F2N3O4S and a molecular weight of 375.40 g/mol. Its IUPAC name is ethyl N-[2-[[4-(difluoromethoxy)phenyl]carbamothioyl-ethylamino]acetyl]carbamate.
| Compound Name | ethyl N-[2-[[4-(difluoromethoxy)phenyl]carbamothioyl-ethylamino]acetyl]carbamate |
|---|---|
| PubChem CID | 8680331 |
| Molecular Formula | C15H19F2N3O4S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | ethyl N-[2-[[4-(difluoromethoxy)phenyl]carbamothioyl-ethylamino]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CN(CC)C(=S)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C15H19F2N3O4S/c1-3-20(9-12(21)19-15(22)23-4-2)14(25)18-10-5-7-11(8-6-10)24-13(16)17/h5-8,13H,3-4,9H2,1-2H3,(H,18,25)(H,19,21,22) |
| InChIKey | VMNBJVOKPQWNQE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|